Products 2989061-51-8
CAS 2989061-51-8 appears in our catalog under these names: (R)-1-(4-(tert-Butyl)phenyl)-2,2,2-trifluoroethan-1-amine (hydrochloride), 95%, 95%, (R)-1-(4-(tert-Butyl)phenyl)-2,2,2-trifluoroethan-1-amine (hydrochloride), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(4-tert-butylphenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 2989061-51-8) is a chemical compound with the molecular formula C12H17ClF3N and a molecular weight of 267.72 g/mol. IUPAC name: (1R)-1-(4-tert-butylphenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: DKPHEQGIRIZKMY-HNCPQSOCSA-N.
| Molecular formula | C12H17ClF3N |
|---|---|
| Molecular weight | 267.72 g/mol |
| IUPAC name | (1R)-1-(4-tert-butylphenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | DKPHEQGIRIZKMY-HNCPQSOCSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)[C@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)