Products 2990057-63-9
CAS 2990057-63-9 appears in our catalog under these names: 3-(5-Bromo-2-chlorophenyl)piperidine-2,6-dione, 3-(5-bromo-2-chloro-phenyl)piperidine-2,6-dione, >95%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 50mg, 100mg, 250mg, 1g.
3-(5-bromo-2-chlorophenyl)piperidine-2,6-dione (CAS 2990057-63-9) is a chemical compound with the molecular formula C11H9BrClNO2 and a molecular weight of 302.55 g/mol. IUPAC name: 3-(5-bromo-2-chlorophenyl)piperidine-2,6-dione. InChIKey: OXMDUBZQQHHYBK-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClNO2 |
|---|---|
| Molecular weight | 302.55 g/mol |
| IUPAC name | 3-(5-bromo-2-chlorophenyl)piperidine-2,6-dione |
| InChIKey | OXMDUBZQQHHYBK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)