Products 2990057-63-9
CAS 2990057-63-9 is the registry number for 3-(5-Bromo-2-chlorophenyl)piperidine-2,6-dione. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(5-bromo-2-chlorophenyl)piperidine-2,6-dione (CAS 2990057-63-9) is a chemical compound with the molecular formula C11H9BrClNO2 and a molecular weight of 302.55 g/mol. IUPAC name: 3-(5-bromo-2-chlorophenyl)piperidine-2,6-dione. InChIKey: OXMDUBZQQHHYBK-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClNO2 |
|---|---|
| Molecular weight | 302.55 g/mol |
| IUPAC name | 3-(5-bromo-2-chlorophenyl)piperidine-2,6-dione |
| InChIKey | OXMDUBZQQHHYBK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)