CAS 2991481-09-3 is the registry number for TMV-IN-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-3-[(R)-(3,4-dimethoxyphenyl)-hydroxymethyl]oxolan-2-one (CAS 2991481-09-3) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: (3R)-3-[(R)-(3,4-dimethoxyphenyl)-hydroxymethyl]oxolan-2-one. InChIKey: AFIWFPFRFUYPJE-SKDRFNHKSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | (3R)-3-[(R)-(3,4-dimethoxyphenyl)-hydroxymethyl]oxolan-2-one |
| InChIKey | AFIWFPFRFUYPJE-SKDRFNHKSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@@H]([C@H]2CCOC2=O)O)OC |
Computed by PubChem (NCBI)