Products 299166-69-1

CAS 299166-69-1 is the registry number for (5-Ethyl-2-methyl-1h-indol-3-yl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(5-ethyl-2-methyl-1H-indol-3-yl)acetic acid (CAS 299166-69-1) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 2-(5-ethyl-2-methyl-1H-indol-3-yl)acetic acid. InChIKey: RCHPIUXYDSGZFY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO2
Molecular weight217.26 g/mol
IUPAC name2-(5-ethyl-2-methyl-1H-indol-3-yl)acetic acid
InChIKeyRCHPIUXYDSGZFY-UHFFFAOYSA-N
SMILESCCC1=CC2=C(C=C1)NC(=C2CC(=O)O)C

Computed by PubChem (NCBI)