Products 299167-10-5

CAS 299167-10-5 is the registry number for 3-(2-Amino-ethyl)-2-methyl-1h-indole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(2-aminoethyl)-2-methyl-1H-indole-5-carboxylic acid (CAS 299167-10-5) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 3-(2-aminoethyl)-2-methyl-1H-indole-5-carboxylic acid. InChIKey: YCNQXJKQBUEVSN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O2
Molecular weight218.25 g/mol
IUPAC name3-(2-aminoethyl)-2-methyl-1H-indole-5-carboxylic acid
InChIKeyYCNQXJKQBUEVSN-UHFFFAOYSA-N
SMILESCC1=C(C2=C(N1)C=CC(=C2)C(=O)O)CCN

Computed by PubChem (NCBI)