Products 2994297-58-2
CAS 2994297-58-2 is the registry number for (3R,3aR,6R,6aR)-6-(2-Pyrimidinyloxy)hexahydrofuro[3,2-b]furan-3-ol, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
6-pyrimidin-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (CAS 2994297-58-2) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: 6-pyrimidin-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol. InChIKey: QWZMRCMGOVXEPY-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 6-pyrimidin-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| InChIKey | QWZMRCMGOVXEPY-UHFFFAOYSA-N |
| SMILES | C1C(C2C(O1)C(CO2)OC3=NC=CC=N3)O |
Computed by PubChem (NCBI)