Products 2995274-62-7
CAS 2995274-62-7 is the registry number for 6-(Ethylsulfonyl)-4-isopropoxypyridin-2-amine, ≥95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-ethylsulfonyl-4-propan-2-yloxypyridin-2-amine (CAS 2995274-62-7) is a chemical compound with the molecular formula C10H16N2O3S and a molecular weight of 244.31 g/mol. IUPAC name: 6-ethylsulfonyl-4-propan-2-yloxypyridin-2-amine. InChIKey: COWCFQYYVQSFBO-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O3S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 6-ethylsulfonyl-4-propan-2-yloxypyridin-2-amine |
| InChIKey | COWCFQYYVQSFBO-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC(=CC(=N1)N)OC(C)C |
Computed by PubChem (NCBI)