Products 2995277-72-8
CAS 2995277-72-8 is the registry number for Ethyl 6-Chloro-4-(1,5-dimethyl-4-pyrazolyl)-5-methylpicolinate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 6-chloro-4-(1,5-dimethylpyrazol-4-yl)-5-methylpyridine-2-carboxylate (CAS 2995277-72-8) is a chemical compound with the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. IUPAC name: ethyl 6-chloro-4-(1,5-dimethylpyrazol-4-yl)-5-methylpyridine-2-carboxylate. InChIKey: RGYTUJYGTQFIDR-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3O2 |
|---|---|
| Molecular weight | 293.75 g/mol |
| IUPAC name | ethyl 6-chloro-4-(1,5-dimethylpyrazol-4-yl)-5-methylpyridine-2-carboxylate |
| InChIKey | RGYTUJYGTQFIDR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(C(=C1)C2=C(N(N=C2)C)C)C)Cl |
Computed by PubChem (NCBI)