Products 2995284-32-5
CAS 2995284-32-5 is the registry number for Methyl 5-[1-(Boc-amino)cyclopropyl]picolinate, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]pyridine-2-carboxylate (CAS 2995284-32-5) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: methyl 5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]pyridine-2-carboxylate. InChIKey: DYNRAEMNDVICPY-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | methyl 5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]pyridine-2-carboxylate |
| InChIKey | DYNRAEMNDVICPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC1)C2=CN=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)