CAS 2995290-26-9 is the registry number for 3-Methyl-3-(4-methylphenyl)pyrrolidine Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
3-methyl-3-(4-methylphenyl)pyrrolidine;hydrochloride (CAS 2995290-26-9) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 3-methyl-3-(4-methylphenyl)pyrrolidine;hydrochloride. InChIKey: SIUDBQSBXUDTFX-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 3-methyl-3-(4-methylphenyl)pyrrolidine;hydrochloride |
| InChIKey | SIUDBQSBXUDTFX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(CCNC2)C.Cl |
Computed by PubChem (NCBI)