Products 29953-72-8
CAS 29953-72-8 is the registry number for cis-3-Indoleacrylic acid. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.
(Z)-3-(1H-indol-3-yl)prop-2-enoic acid (CAS 29953-72-8) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: (Z)-3-(1H-indol-3-yl)prop-2-enoic acid. InChIKey: PLVPPLCLBIEYEA-WAYWQWQTSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | (Z)-3-(1H-indol-3-yl)prop-2-enoic acid |
| InChIKey | PLVPPLCLBIEYEA-WAYWQWQTSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C=C\C(=O)O |
Computed by PubChem (NCBI)