Products 29955-37-1
CAS 29955-37-1 appears in our catalog under these names: 4-Hydroxy-6-oxo-1,6-dihydropyrimidine-5-carbaldehyde oxime, 98%, 98%, 6-hydroxy-5-[(E)-(hydroxyimino)methyl]-3,4-dihydropyrimidin-4-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-hydroxy-5-[(E)-hydroxyiminomethyl]-1H-pyrimidin-6-one (CAS 29955-37-1) is a chemical compound with the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. IUPAC name: 4-hydroxy-5-[(E)-hydroxyiminomethyl]-1H-pyrimidin-6-one. InChIKey: FIABSTHYYTZLPA-UNXLUWIOSA-N.
| Molecular formula | C5H5N3O3 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 4-hydroxy-5-[(E)-hydroxyiminomethyl]-1H-pyrimidin-6-one |
| InChIKey | FIABSTHYYTZLPA-UNXLUWIOSA-N |
| SMILES | C1=NC(=C(C(=O)N1)/C=N/O)O |
Computed by PubChem (NCBI)