Products 29979-41-7
CAS 29979-41-7 appears in our catalog under these names: (R)-2-Amino-3-(2,4,5-trihydroxyphenyl)propanoic acid, 95%, (2R)-2-amino-3-(2,4,5-trihydroxyphenyl)propanoic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 100mg, 500mg, 1g.
(2R)-2-amino-3-(2,4,5-trihydroxyphenyl)propanoic acid (CAS 29979-41-7) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: (2R)-2-amino-3-(2,4,5-trihydroxyphenyl)propanoic acid. InChIKey: YLKRUSPZOTYMAT-RXMQYKEDSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,4,5-trihydroxyphenyl)propanoic acid |
| InChIKey | YLKRUSPZOTYMAT-RXMQYKEDSA-N |
| SMILES | C1=C(C(=CC(=C1O)O)O)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)