CAS 299965-85-8 appears in our catalog under these names: 5-Methoxy-2-methylbenzo(d)thiazol-6-amine, 97%, 6–Benzothiazolamine，5–methoxy–2–methyl–(9CI), 5-Methoxy-2-methyl-1,3-benzothiazol-6-amine. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
5-methoxy-2-methyl-1,3-benzothiazol-6-amine (CAS 299965-85-8) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 5-methoxy-2-methyl-1,3-benzothiazol-6-amine. InChIKey: RHXTVXUTSAGLOS-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 5-methoxy-2-methyl-1,3-benzothiazol-6-amine |
| InChIKey | RHXTVXUTSAGLOS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C(=C2)OC)N |
Computed by PubChem (NCBI)