CAS 3002-81-1 appears in our catalog under these names: 5,6–Dimethyl–1,10–phenanthroline, 5,6-Dimethyl-1,10-phenanthroline, 5,6-Dimethyl-1,10-phenanthroline, >98.0%(HPLC)(T), 5,6-Dimethyl-1,10-phenanthroline 98%, 5,6-DIMETHYL-1,10-PHENANTHROLINE,97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 250mg, 5g, 50000mg, 100mg, 10g, 500MG, 25g.
5,6-dimethyl-1,10-phenanthroline (CAS 3002-81-1) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 5,6-dimethyl-1,10-phenanthroline. InChIKey: BRPQDJPJBCQFSR-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 5,6-dimethyl-1,10-phenanthroline |
| InChIKey | BRPQDJPJBCQFSR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C3=C1C=CC=N3)N=CC=C2)C |
Computed by PubChem (NCBI)