Products 3002476-27-6
CAS 3002476-27-6 is the registry number for (3-chloro-2-fluoropyridin-4-yl)(cyclohexyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3-chloro-2-fluoro-4-pyridinyl)-cyclohexylmethanol (CAS 3002476-27-6) is a chemical compound with the molecular formula C12H15ClFNO and a molecular weight of 243.70 g/mol. IUPAC name: (3-chloro-2-fluoro-4-pyridinyl)-cyclohexylmethanol. InChIKey: VKCHTVJDORKPJK-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFNO |
|---|---|
| Molecular weight | 243.70 g/mol |
| IUPAC name | (3-chloro-2-fluoro-4-pyridinyl)-cyclohexylmethanol |
| InChIKey | VKCHTVJDORKPJK-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C2=C(C(=NC=C2)F)Cl)O |
Computed by PubChem (NCBI)