Products 3002513-69-8
CAS 3002513-69-8 is the registry number for (2,6-difluoro-3-(methylthio)phenyl)(phenyl)methanone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,6-difluoro-3-methylsulfanylphenyl)-phenylmethanone (CAS 3002513-69-8) is a chemical compound with the molecular formula C14H10F2OS and a molecular weight of 264.29 g/mol. IUPAC name: (2,6-difluoro-3-methylsulfanylphenyl)-phenylmethanone. InChIKey: JOESBWZEYCRFRH-UHFFFAOYSA-N.
| Molecular formula | C14H10F2OS |
|---|---|
| Molecular weight | 264.29 g/mol |
| IUPAC name | (2,6-difluoro-3-methylsulfanylphenyl)-phenylmethanone |
| InChIKey | JOESBWZEYCRFRH-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)F)C(=O)C2=CC=CC=C2)F |
Computed by PubChem (NCBI)