Products 3002523-33-0
CAS 3002523-33-0 is the registry number for 3-(4-methoxy-2-(trifluoromethyl)phenyl)oxetan-3-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[4-methoxy-2-(trifluoromethyl)phenyl]oxetan-3-ol (CAS 3002523-33-0) is a chemical compound with the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. IUPAC name: 3-[4-methoxy-2-(trifluoromethyl)phenyl]oxetan-3-ol. InChIKey: YNXAMNXCYMUJEP-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O3 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | 3-[4-methoxy-2-(trifluoromethyl)phenyl]oxetan-3-ol |
| InChIKey | YNXAMNXCYMUJEP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2(COC2)O)C(F)(F)F |
Computed by PubChem (NCBI)