Products 3002525-40-5
CAS 3002525-40-5 is the registry number for 1-(5-bromo-2-fluoro-3-methoxyphenyl)propan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
1-(5-bromo-2-fluoro-3-methoxyphenyl)propan-1-one (CAS 3002525-40-5) is a chemical compound with the molecular formula C10H10BrFO2 and a molecular weight of 261.09 g/mol. IUPAC name: 1-(5-bromo-2-fluoro-3-methoxyphenyl)propan-1-one. InChIKey: ROLNQJVSCAYCCT-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO2 |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | 1-(5-bromo-2-fluoro-3-methoxyphenyl)propan-1-one |
| InChIKey | ROLNQJVSCAYCCT-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C(=CC(=C1)Br)OC)F |
Computed by PubChem (NCBI)