CAS 300374-83-8 appears in our catalog under these names: 1-(3,4-Dimethoxyphenyl)-2,2,2-trifluoroethanone 95%, 1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethan-1-one, 95%, 95%, 3',4'-Dimethoxy-2,2,2-trifluoroacetophenone, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethanone (CAS 300374-83-8) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethanone. InChIKey: YFISYXOGMSGFRE-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethanone |
| InChIKey | YFISYXOGMSGFRE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C(F)(F)F)OC |
Computed by PubChem (NCBI)