CAS 301164-69-2 is the registry number for 1-(Thiophene-2-carbonyl)-1H-1,2,3-benzotriazole, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
Benzotriazol-1-yl(thiophen-2-yl)methanone (CAS 301164-69-2) is a chemical compound with the molecular formula C11H7N3OS and a molecular weight of 229.26 g/mol. IUPAC name: benzotriazol-1-yl(thiophen-2-yl)methanone. InChIKey: NPHXTBJFXYNMCF-UHFFFAOYSA-N.
| Molecular formula | C11H7N3OS |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | benzotriazol-1-yl(thiophen-2-yl)methanone |
| InChIKey | NPHXTBJFXYNMCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2C(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)