CAS 790273-74-4 is the registry number for 3-Cyano-N-(thiazol-2-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyano-N-(1,3-thiazol-2-yl)benzamide (CAS 790273-74-4) is a chemical compound with the molecular formula C11H7N3OS and a molecular weight of 229.26 g/mol. IUPAC name: 3-cyano-N-(1,3-thiazol-2-yl)benzamide. InChIKey: RKLJUOQCIMPULR-UHFFFAOYSA-N.
| Molecular formula | C11H7N3OS |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 3-cyano-N-(1,3-thiazol-2-yl)benzamide |
| InChIKey | RKLJUOQCIMPULR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)NC2=NC=CS2)C#N |
Computed by PubChem (NCBI)