CAS 70638-52-7 appears in our catalog under these names: 4-Oxo-6-phenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile, 95%, 4-Hydroxy-6-phenyl-2-sulfanylpyrimidine-5-carbonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-oxo-6-phenyl-2-sulfanylidene-1H-pyrimidine-5-carbonitrile (CAS 70638-52-7) is a chemical compound with the molecular formula C11H7N3OS and a molecular weight of 229.26 g/mol. IUPAC name: 4-oxo-6-phenyl-2-sulfanylidene-1H-pyrimidine-5-carbonitrile. InChIKey: IRXNEFZOFSGSIL-UHFFFAOYSA-N.
| Molecular formula | C11H7N3OS |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 4-oxo-6-phenyl-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| InChIKey | IRXNEFZOFSGSIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC(=S)N2)C#N |
Computed by PubChem (NCBI)