CAS 72632-99-6 appears in our catalog under these names: 3-Phenyl-6H,7H-(1,2)thiazolo(4,5-d)pyrimidin-7-one, 98%, 3-Phenyl-6H,7H-(1,2)thiazolo(4,5-d)pyrimidin-7-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-phenyl-6H-[1,2]thiazolo[4,5-d]pyrimidin-7-one (CAS 72632-99-6) is a chemical compound with the molecular formula C11H7N3OS and a molecular weight of 229.26 g/mol. IUPAC name: 3-phenyl-6H-[1,2]thiazolo[4,5-d]pyrimidin-7-one. InChIKey: PYERYCKBJGGKEV-UHFFFAOYSA-N.
| Molecular formula | C11H7N3OS |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 3-phenyl-6H-[1,2]thiazolo[4,5-d]pyrimidin-7-one |
| InChIKey | PYERYCKBJGGKEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC3=C2N=CNC3=O |
Computed by PubChem (NCBI)