Products 301373-09-1
CAS 301373-09-1 is the registry number for 2-(2-Bromophenyl)-3-hydroxyprop-2-enenitrile, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(2-bromophenyl)-3-oxopropanenitrile (CAS 301373-09-1) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 2-(2-bromophenyl)-3-oxopropanenitrile. InChIKey: PRNKQJJETBWDPX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 2-(2-bromophenyl)-3-oxopropanenitrile |
| InChIKey | PRNKQJJETBWDPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C=O)C#N)Br |
Computed by PubChem (NCBI)