CAS 30240-13-2 is the registry number for Topiroxostat Impurity 51. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-N,4-N-dihydroxypyridine-2,4-dicarboxamide (CAS 30240-13-2) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: 2-N,4-N-dihydroxypyridine-2,4-dicarboxamide. InChIKey: XQBFCJKJPCPQKA-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | 2-N,4-N-dihydroxypyridine-2,4-dicarboxamide |
| InChIKey | XQBFCJKJPCPQKA-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(=O)NO)C(=O)NO |
Computed by PubChem (NCBI)