Products 302553-00-0

CAS 302553-00-0 is the registry number for 6-Bromo-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

6-bromo-4-oxo-1H-quinoline-3-carboxylic acid (CAS 302553-00-0) is a chemical compound with the molecular formula C10H6BrNO3 and a molecular weight of 268.06 g/mol. IUPAC name: 6-bromo-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: GIUZUAUCCUFVKW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6BrNO3
Molecular weight268.06 g/mol
IUPAC name6-bromo-4-oxo-1H-quinoline-3-carboxylic acid
InChIKeyGIUZUAUCCUFVKW-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Br)C(=O)C(=CN2)C(=O)O

Computed by PubChem (NCBI)