Products 668971-60-6
CAS 668971-60-6 appears in our catalog under these names: 5-(2-Bromophenyl)isoxazole-3-carboxylic acid, 97%, 5-(2-Bromophenyl)-1,2-oxazole-3-carboxylic acid, 5-(2-bromophenyl)-1,2-oxazole-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g, 0,5g.
5-(2-bromophenyl)-1,2-oxazole-3-carboxylic acid (CAS 668971-60-6) is a chemical compound with the molecular formula C10H6BrNO3 and a molecular weight of 268.06 g/mol. IUPAC name: 5-(2-bromophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: STNYQQXPSDJBQB-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO3 |
|---|---|
| Molecular weight | 268.06 g/mol |
| IUPAC name | 5-(2-bromophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | STNYQQXPSDJBQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=NO2)C(=O)O)Br |
Computed by PubChem (NCBI)