Products 887408-14-2
CAS 887408-14-2 is the registry number for 5-(4-Bromophenyl)isoxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-(4-bromophenyl)-1,2-oxazole-4-carboxylic acid (CAS 887408-14-2) is a chemical compound with the molecular formula C10H6BrNO3 and a molecular weight of 268.06 g/mol. IUPAC name: 5-(4-bromophenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: JACKYDJBTWSWKS-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO3 |
|---|---|
| Molecular weight | 268.06 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | JACKYDJBTWSWKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=NO2)C(=O)O)Br |
Computed by PubChem (NCBI)