CAS 552330-93-5 appears in our catalog under these names: 6-Bromo-3-hydroxyquinoline-4-carboxylic acid, 90%, 6-Bromo-3-hydroxyquinoline-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
6-bromo-3-hydroxyquinoline-4-carboxylic acid (CAS 552330-93-5) is a chemical compound with the molecular formula C10H6BrNO3 and a molecular weight of 268.06 g/mol. IUPAC name: 6-bromo-3-hydroxyquinoline-4-carboxylic acid. InChIKey: PHFJIUZKWPELKO-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO3 |
|---|---|
| Molecular weight | 268.06 g/mol |
| IUPAC name | 6-bromo-3-hydroxyquinoline-4-carboxylic acid |
| InChIKey | PHFJIUZKWPELKO-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1Br)C(=O)O)O |
Computed by PubChem (NCBI)