Products 3026594-94-2
CAS 3026594-94-2 is the registry number for (R)-1-((4-bromo-3-nitrobenzyl)oxy)propan-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
(2R)-1-[(4-bromo-3-nitrophenyl)methoxy]propan-2-amine (CAS 3026594-94-2) is a chemical compound with the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. IUPAC name: (2R)-1-[(4-bromo-3-nitrophenyl)methoxy]propan-2-amine. InChIKey: SBTZOPQOHZYWIF-SSDOTTSWSA-N.
| Molecular formula | C10H13BrN2O3 |
|---|---|
| Molecular weight | 289.13 g/mol |
| IUPAC name | (2R)-1-[(4-bromo-3-nitrophenyl)methoxy]propan-2-amine |
| InChIKey | SBTZOPQOHZYWIF-SSDOTTSWSA-N |
| SMILES | C[C@H](COCC1=CC(=C(C=C1)Br)[N+](=O)[O-])N |
Computed by PubChem (NCBI)