CAS 3026595-75-2 is the registry number for Methyl (3R,4S)-4-(4-cyanophenyl)pyrrolidine-3-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl (3R,4S)-4-(4-cyanophenyl)pyrrolidine-3-carboxylate;hydrochloride (CAS 3026595-75-2) is a chemical compound with the molecular formula C13H15ClN2O2 and a molecular weight of 266.72 g/mol. IUPAC name: methyl (3R,4S)-4-(4-cyanophenyl)pyrrolidine-3-carboxylate;hydrochloride. InChIKey: BFQJLQFXERJVMF-LYCTWNKOSA-N.
| Molecular formula | C13H15ClN2O2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | methyl (3R,4S)-4-(4-cyanophenyl)pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | BFQJLQFXERJVMF-LYCTWNKOSA-N |
| SMILES | COC(=O)[C@H]1CNC[C@@H]1C2=CC=C(C=C2)C#N.Cl |
Computed by PubChem (NCBI)