Products 3026598-46-6
CAS 3026598-46-6 is the registry number for (2R,5R)-1-ethyl-2,5-dimethylpiperazine dihydrochloride, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2R,5R)-1-ethyl-2,5-dimethylpiperazine;dihydrochloride (CAS 3026598-46-6) is a chemical compound with the molecular formula C8H20Cl2N2 and a molecular weight of 215.16 g/mol. IUPAC name: (2R,5R)-1-ethyl-2,5-dimethylpiperazine;dihydrochloride. InChIKey: RYRZTUGIMSVVCZ-RHJRFJOKSA-N.
| Molecular formula | C8H20Cl2N2 |
|---|---|
| Molecular weight | 215.16 g/mol |
| IUPAC name | (2R,5R)-1-ethyl-2,5-dimethylpiperazine;dihydrochloride |
| InChIKey | RYRZTUGIMSVVCZ-RHJRFJOKSA-N |
| SMILES | CCN1C[C@H](NC[C@H]1C)C.Cl.Cl |
Computed by PubChem (NCBI)