Products 3026716-25-3
CAS 3026716-25-3 is the registry number for 1-(methoxycarbonyl)-2-oxabicyclo[2.2.1]heptane-4-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-methoxycarbonyl-2-oxabicyclo[2.2.1]heptane-4-carboxylic acid (CAS 3026716-25-3) is a chemical compound with the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. IUPAC name: 1-methoxycarbonyl-2-oxabicyclo[2.2.1]heptane-4-carboxylic acid. InChIKey: ZWYFQQYGESDBEL-UHFFFAOYSA-N.
| Molecular formula | C9H12O5 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 1-methoxycarbonyl-2-oxabicyclo[2.2.1]heptane-4-carboxylic acid |
| InChIKey | ZWYFQQYGESDBEL-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCC(C1)(CO2)C(=O)O |
Computed by PubChem (NCBI)