Products 3027083-73-1
CAS 3027083-73-1 is the registry number for Antibiofilm agent-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E,4E)-N-[(3S)-2-oxooxolan-3-yl]-5-phenylpenta-2,4-dienamide (CAS 3027083-73-1) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: (2E,4E)-N-[(3S)-2-oxooxolan-3-yl]-5-phenylpenta-2,4-dienamide. InChIKey: GGTSFZXYFLSUEU-RNJYJSSVSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | (2E,4E)-N-[(3S)-2-oxooxolan-3-yl]-5-phenylpenta-2,4-dienamide |
| InChIKey | GGTSFZXYFLSUEU-RNJYJSSVSA-N |
| SMILES | C1COC(=O)[C@H]1NC(=O)/C=C/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
Antibiofilm agent-4, orb3133273