Products 302904-35-4

CAS 302904-35-4 is the registry number for 2-(2-(2-(p-Tolyloxy)acetyl)hydrazinecarbonyl)benzoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[[2-(4-methylphenoxy)acetyl]amino]carbamoyl]benzoic acid (CAS 302904-35-4) is a chemical compound with the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. IUPAC name: 2-[[[2-(4-methylphenoxy)acetyl]amino]carbamoyl]benzoic acid. InChIKey: QMIVENRLKSJMPV-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16N2O5
Molecular weight328.32 g/mol
IUPAC name2-[[[2-(4-methylphenoxy)acetyl]amino]carbamoyl]benzoic acid
InChIKeyQMIVENRLKSJMPV-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)OCC(=O)NNC(=O)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)