CAS 70838-44-7 appears in our catalog under these names: 5'-O-Benzoyl-2,3'-anhydrothymidine, 95%, 5'-O-Benzoyl-2,3'-anhydrothymidine. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 5mg, 50mg, 500mg.
[(1R,9R,10R)-4-methyl-5-oxo-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-10-yl]methyl benzoate (CAS 70838-44-7) is a chemical compound with the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. IUPAC name: [(1R,9R,10R)-4-methyl-5-oxo-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-10-yl]methyl benzoate. InChIKey: WUQUVOAMQGVMKB-MGPQQGTHSA-N.
| Molecular formula | C17H16N2O5 |
|---|---|
| Molecular weight | 328.32 g/mol |
| IUPAC name | [(1R,9R,10R)-4-methyl-5-oxo-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-10-yl]methyl benzoate |
| InChIKey | WUQUVOAMQGVMKB-MGPQQGTHSA-N |
| SMILES | CC1=CN2[C@H]3C[C@H]([C@H](O3)COC(=O)C4=CC=CC=C4)OC2=NC1=O |
Computed by PubChem (NCBI)