Products 50428-14-3
CAS 50428-14-3 appears in our catalog under these names: Nifedipine EP Impurity B, Nifedipine EP Impurity B (Dehydronitroso Nifedipine), Dehydronitroso Nifedipine, >95% (HPLC), Dimethyl 2,6-Dimethyl-4-(2-nitrosophenyl)pyridine-3,5-dicarboxylate (Nitrosophenylpyridine Analogue of Nifedipine), Dehydronitroso nifedipine. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Chemat. Available pack sizes: on request, 100mg, 25mg, 5mg, 50mg, 250mg, 500mg, 1g.
Dimethyl 2,6-dimethyl-4-(2-nitrosophenyl)pyridine-3,5-dicarboxylate (CAS 50428-14-3) is a chemical compound with the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. IUPAC name: dimethyl 2,6-dimethyl-4-(2-nitrosophenyl)pyridine-3,5-dicarboxylate. InChIKey: MUZLTKGYFZENFW-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O5 |
|---|---|
| Molecular weight | 328.32 g/mol |
| IUPAC name | dimethyl 2,6-dimethyl-4-(2-nitrosophenyl)pyridine-3,5-dicarboxylate |
| InChIKey | MUZLTKGYFZENFW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC)C2=CC=CC=C2N=O)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
DehydronitrosoNifedipine, 2,6-Ntp, DNPDC, nitrosonifedipine, 2,6-Dimethyl-4-(2'-nitrosophenyl)-3,5-pyridinedicarboxylic acid dimethyl ester, Dehydronitroso Nifedipine, dimethyl 2,6-dimethyl-4-(2-nitrosophenyl)pyridine-3,5-dicarboxylate, Nifedipine EP Impurity B, Nifedipine impurity B CRS, NIFEDIPINE MAJOR DEGRADANT