Products 38806-34-7
CAS 38806-34-7 is the registry number for Ac-DL-Phe-ONp. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
(4-nitrophenyl) 2-acetamido-3-phenylpropanoate (CAS 38806-34-7) is a chemical compound with the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. IUPAC name: (4-nitrophenyl) 2-acetamido-3-phenylpropanoate. InChIKey: OBFGGGOSBTXXCS-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O5 |
|---|---|
| Molecular weight | 328.32 g/mol |
| IUPAC name | (4-nitrophenyl) 2-acetamido-3-phenylpropanoate |
| InChIKey | OBFGGGOSBTXXCS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC1=CC=CC=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
N-Acetyl-dl-phenylalanine p-nitrophenyl ester, (4-nitrophenyl) 2-acetamido-3-phenylpropanoate, 4-Nitrophenyl N-acetyl-3-phenyl-DL-alaninate, Acetyl-DL-phenylalanine 4-nitrophenyl ester, DL-Phenylalanine, N-acetyl-, 4-nitrophenyl ester, 4-Nitrophenyl 2-(acetylamino)-3-phenylpropanoate #, N-[1-(4-Nitrophenoxy)-1-oxo-3-phenylpropan-2-yl]ethanimidic acid