Products 3029263-08-6
CAS 3029263-08-6 is the registry number for Methyl 1-(3-bromophenyl)cyclopentane-1-carboxylate, 95+%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 1-(3-bromophenyl)cyclopentane-1-carboxylate (CAS 3029263-08-6) is a chemical compound with the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. IUPAC name: methyl 1-(3-bromophenyl)cyclopentane-1-carboxylate. InChIKey: YGAWZWYEMNRJQJ-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO2 |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | methyl 1-(3-bromophenyl)cyclopentane-1-carboxylate |
| InChIKey | YGAWZWYEMNRJQJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCCC1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)