Products 3029270-15-0
CAS 3029270-15-0 is the registry number for N-(3-Ethylbenzylidene)-4-methylbenzenesulfonamide, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(NE)-N-[(3-ethylphenyl)methylidene]-4-methylbenzenesulfonamide (CAS 3029270-15-0) is a chemical compound with the molecular formula C16H17NO2S and a molecular weight of 287.4 g/mol. IUPAC name: (NE)-N-[(3-ethylphenyl)methylidene]-4-methylbenzenesulfonamide. InChIKey: VFPDZHJXRIJUNJ-SFQUDFHCSA-N.
| Molecular formula | C16H17NO2S |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | (NE)-N-[(3-ethylphenyl)methylidene]-4-methylbenzenesulfonamide |
| InChIKey | VFPDZHJXRIJUNJ-SFQUDFHCSA-N |
| SMILES | CCC1=CC(=CC=C1)/C=N/S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)