CAS 302949-31-1 is the registry number for 2-(4-Chloro-3,5-dimethylphenoxy)propanohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-chloro-3,5-dimethylphenoxy)propanehydrazide (CAS 302949-31-1) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: 2-(4-chloro-3,5-dimethylphenoxy)propanehydrazide. InChIKey: XDAQXAPOGMEXLH-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 2-(4-chloro-3,5-dimethylphenoxy)propanehydrazide |
| InChIKey | XDAQXAPOGMEXLH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C)OC(C)C(=O)NN |
Computed by PubChem (NCBI)