CAS 302963-94-6 appears in our catalog under these names: N-Boc-amino-4-methylthiazole-5-carboxylic acid, 97%, 2-((tert-Butoxycarbonyl)amino)-4-methylthiazole-5-carboxylic acid, 95%, 95%, N-Boc-Amino-4-methylthiazole-5-carboxylic acid, 95%, 2-((tert-Butoxycarbonyl)amino)-4-methylthiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g, 100g.
4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid (CAS 302963-94-6) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid. InChIKey: FHNRXEYKJBDNKP-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid |
| InChIKey | FHNRXEYKJBDNKP-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)