Products 303037-50-5

CAS 303037-50-5 is the registry number for 2-(4-Amino-1-((benzyloxy)carbonyl)piperidin-4-yl)acetic acid, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-amino-1-phenylmethoxycarbonylpiperidin-4-yl)acetic acid (CAS 303037-50-5) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: 2-(4-amino-1-phenylmethoxycarbonylpiperidin-4-yl)acetic acid. InChIKey: OFFFCYNKZALCMH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20N2O4
Molecular weight292.33 g/mol
IUPAC name2-(4-amino-1-phenylmethoxycarbonylpiperidin-4-yl)acetic acid
InChIKeyOFFFCYNKZALCMH-UHFFFAOYSA-N
SMILESC1CN(CCC1(CC(=O)O)N)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)