Products 3031072-69-9
CAS 3031072-69-9 is the registry number for YZL-51N, 95.0%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 25 mg, 5 mg.
Methyl (Z)-2,4-bis(3,4-dihydroxyphenyl)-4-oxobut-2-enoate (CAS 3031072-69-9) is a chemical compound with the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. IUPAC name: methyl (Z)-2,4-bis(3,4-dihydroxyphenyl)-4-oxobut-2-enoate. InChIKey: HZWOUVYWQBKNFS-FLIBITNWSA-N.
| Molecular formula | C17H14O7 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | methyl (Z)-2,4-bis(3,4-dihydroxyphenyl)-4-oxobut-2-enoate |
| InChIKey | HZWOUVYWQBKNFS-FLIBITNWSA-N |
| SMILES | COC(=O)/C(=C\C(=O)C1=CC(=C(C=C1)O)O)/C2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)