CAS 303145-40-6 appears in our catalog under these names: 5-(3-Chlorophenyl)-2,3-dihydro-1H-pyrrolizine-6,7-dicarboxylic acid, 90%, 5-(3-Chlorophenyl)-2,3-dihydro-1H-pyrrolizine-6,7-dicarboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(3-chlorophenyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylic acid (CAS 303145-40-6) is a chemical compound with the molecular formula C15H12ClNO4 and a molecular weight of 305.71 g/mol. IUPAC name: 3-(3-chlorophenyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylic acid. InChIKey: LRIHSKNOBAGNNP-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO4 |
|---|---|
| Molecular weight | 305.71 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylic acid |
| InChIKey | LRIHSKNOBAGNNP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=C(N2C1)C3=CC(=CC=C3)Cl)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)