Products 3031792-79-4
CAS 3031792-79-4 is the registry number for 4-[1-(3,4-Dimethylphenyl)ethyl]-1H-imidazole Hydrochloride, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-[1-(3,4-dimethylphenyl)ethyl]-1H-imidazole;hydrochloride (CAS 3031792-79-4) is a chemical compound with the molecular formula C13H17ClN2 and a molecular weight of 236.74 g/mol. IUPAC name: 5-[1-(3,4-dimethylphenyl)ethyl]-1H-imidazole;hydrochloride. InChIKey: KWFVEDRYKROWPV-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | 5-[1-(3,4-dimethylphenyl)ethyl]-1H-imidazole;hydrochloride |
| InChIKey | KWFVEDRYKROWPV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)C2=CN=CN2)C.Cl |
Computed by PubChem (NCBI)