CAS 3033437-88-3 is the registry number for 2-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)pyrrolidine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine;hydrochloride (CAS 3033437-88-3) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine;hydrochloride. InChIKey: GTLDAABLJLQXMY-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine;hydrochloride |
| InChIKey | GTLDAABLJLQXMY-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC3=C(C=C2)OCCO3.Cl |
Computed by PubChem (NCBI)