Products 30358-88-4
CAS 30358-88-4 appears in our catalog under these names: 3'-O-Acetylhamaudol/ 99.55% (existing batch purity), 3'-?o-?Acetylhamaudol, 3'-O-Acetylhamaudol 98%, 3'-O-Acetylhamaudol, 99.57%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 20mg, 5 mg.
[(3S)-5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] acetate (CAS 30358-88-4) is a chemical compound with the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. IUPAC name: [(3S)-5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] acetate. InChIKey: ZHMBJOBSCRAOAO-AWEZNQCLSA-N.
| Molecular formula | C17H18O6 |
|---|---|
| Molecular weight | 318.32 g/mol |
| IUPAC name | [(3S)-5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] acetate |
| InChIKey | ZHMBJOBSCRAOAO-AWEZNQCLSA-N |
| SMILES | CC1=CC(=O)C2=C(C3=C(C=C2O1)OC([C@H](C3)OC(=O)C)(C)C)O |
Computed by PubChem (NCBI)