Products 3037659-10-9
CAS 3037659-10-9 is the registry number for tert-Butyl (R)-3-(2-hydroxyethyl)piperazine-1-carboxylate hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (3R)-3-(2-hydroxyethyl)piperazine-1-carboxylate;hydrochloride (CAS 3037659-10-9) is a chemical compound with the molecular formula C11H23ClN2O3 and a molecular weight of 266.76 g/mol. IUPAC name: tert-butyl (3R)-3-(2-hydroxyethyl)piperazine-1-carboxylate;hydrochloride. InChIKey: ZGBAPSSSMKGGGH-SBSPUUFOSA-N.
| Molecular formula | C11H23ClN2O3 |
|---|---|
| Molecular weight | 266.76 g/mol |
| IUPAC name | tert-butyl (3R)-3-(2-hydroxyethyl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | ZGBAPSSSMKGGGH-SBSPUUFOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)CCO.Cl |
Computed by PubChem (NCBI)